C7H13NO6 — CID 118539637
2-hydroxy-3-(2-methoxyethylamino)butanedioic acid (PubChem CID 118539637) has the molecular formula C7H13NO6 and a molecular weight of 207.18 g/mol. Its IUPAC name is 2-hydroxy-3-(2-methoxyethylamino)butanedioic acid.
| Compound Name | 2-hydroxy-3-(2-methoxyethylamino)butanedioic acid |
|---|---|
| PubChem CID | 118539637 |
| Molecular Formula | C7H13NO6 |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 2-hydroxy-3-(2-methoxyethylamino)butanedioic acid |
| SMILES | COCCNC(C(=O)O)C(O)C(=O)O |
| InChI | InChI=1S/C7H13NO6/c1-14-3-2-8-4(6(10)11)5(9)7(12)13/h4-5,8-9H,2-3H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | PFLWTZLBJHPJMG-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|