C5H8N2O11P2 — CID 118539946
2,4-dioxo-1H-pyrimidine-6-carboxylic acid;phosphono dihydrogen phosphate (PubChem CID 118539946) has the molecular formula C5H8N2O11P2 and a molecular weight of 334.07 g/mol. Its IUPAC name is 2,4-dioxo-1H-pyrimidine-6-carboxylic acid;phosphono dihydrogen phosphate.
| Compound Name | 2,4-dioxo-1H-pyrimidine-6-carboxylic acid;phosphono dihydrogen phosphate |
|---|---|
| PubChem CID | 118539946 |
| Molecular Formula | C5H8N2O11P2 |
| Molecular Weight | 334.07 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | 2,4-dioxo-1H-pyrimidine-6-carboxylic acid;phosphono dihydrogen phosphate |
| SMILES | O=C(O)c1cc(=O)[nH]c(=O)[nH]1.O=P(O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C5H4N2O4.H4O7P2/c8-3-1-2(4(9)10)6-5(11)7-3;1-8(2,3)7-9(4,5)6/h1H,(H,9,10)(H2,6,7,8,11);(H2,1,2,3)(H2,4,5,6) |
| InChIKey | WFTJZLYLPQXHDH-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 227.31 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.07 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|