C25H39F3N10O7SZn — CID 118541008
[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-[[6-oxo-6-(1,4,7,10-tetrazacyclododec-1-yl)hexyl]carbamoyl]oxolan-3-yl] trifluoromethanesulfonate;zinc (PubChem CID 118541008) has the molecular formula C25H39F3N10O7SZn and a molecular weight of 746.10 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-[[6-oxo-6-(1,4,7,10-tetrazacyclododec-1-yl)hexyl]carbamoyl]oxolan-3-yl] trifluoromethanesulfonate;zinc.
| Compound Name | [(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-[[6-oxo-6-(1,4,7,10-tetrazacyclododec-1-yl)hexyl]carbamoyl]oxolan-3-yl] trifluoromethanesulfonate;zinc |
|---|---|
| PubChem CID | 118541008 |
| Molecular Formula | C25H39F3N10O7SZn |
| Molecular Weight | 746.10 g/mol |
| Exact Mass | 744.20 |
| IUPAC Name | [(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-[[6-oxo-6-(1,4,7,10-tetrazacyclododec-1-yl)hexyl]carbamoyl]oxolan-3-yl] trifluoromethanesulfonate;zinc |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](C(=O)NCCCCCC(=O)N2CCNCCNCCNCC2)[C@@H](OS(=O)(=O)C(F)(F)F)[C@H]1O.[Zn] |
| InChI | InChI=1S/C25H39F3N10O7S.Zn/c26-25(27,28)46(42,43)45-19-18(40)24(38-15-36-17-21(29)34-14-35-22(17)38)44-20(19)23(41)33-5-3-1-2-4-16(39)37-12-10-31-8-6-30-7-9-32-11-13-37;/h14-15,18-20,24,30-32,40H,1-13H2,(H,33,41)(H2,29,34,35);/t18-,19+,20+,24-;/m1./s1 |
| InChIKey | ZJXWSHGVMQDWMY-OGKOPBHESA-N |
| XLogP | -1.81 |
| TPSA | 227.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.10 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|