About N-[(1-oxo-3,4-dihydro-2H-pyrido[4,3-b]indol-5-yl)methyl]acetamide
N-[(1-oxo-3,4-dihydro-2H-pyrido[4,3-b]indol-5-yl)methyl]acetamide (PubChem CID 118548633) has the molecular formula C14H15N3O2
and a molecular weight of 257.29 g/mol. Its IUPAC name is N-[(1-oxo-3,4-dihydro-2H-pyrido[4,3-b]indol-5-yl)methyl]acetamide.
Molecular Properties
| Compound Name | N-[(1-oxo-3,4-dihydro-2H-pyrido[4,3-b]indol-5-yl)methyl]acetamide |
| PubChem CID | 118548633 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-[(1-oxo-3,4-dihydro-2H-pyrido[4,3-b]indol-5-yl)methyl]acetamide |
| SMILES | CC(=O)NCn1c2c(c3ccccc31)C(=O)NCC2 |
| InChI | InChI=1S/C14H15N3O2/c1-9(18)16-8-17-11-5-3-2-4-10(11)13-12(17)6-7-15-14(13)19/h2-5H,6-8H2,1H3,(H,15,19)(H,16,18) |
| InChIKey | BYNJAUVLXXSZRX-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1-oxo-3,4-dihydro-2H-pyrido[4,3-b]indol-5-yl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-oxo-3,4-dihydro-2H-pyrido[4,3-b]indol-5-yl)methyl]acetamide?
The IUPAC name of N-[(1-oxo-3,4-dihydro-2H-pyrido[4,3-b]indol-5-yl)methyl]acetamide (CID 118548633) is N-[(1-oxo-3,4-dihydro-2H-pyrido[4,3-b]indol-5-yl)methyl]acetamide.
What is the SMILES notation for N-[(1-oxo-3,4-dihydro-2H-pyrido[4,3-b]indol-5-yl)methyl]acetamide?
The canonical SMILES for N-[(1-oxo-3,4-dihydro-2H-pyrido[4,3-b]indol-5-yl)methyl]acetamide is CC(=O)NCn1c2c(c3ccccc31)C(=O)NCC2.
What is the InChIKey of N-[(1-oxo-3,4-dihydro-2H-pyrido[4,3-b]indol-5-yl)methyl]acetamide?
The InChIKey is BYNJAUVLXXSZRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O2/c1-9(18)16-8-17-11-5-3-2-4-10(11)13-12(17)6-7-15-14(13)19/h2-5H,6-8H2,1H3,(H,15,19)(H,16,18).
What are the key properties of N-[(1-oxo-3,4-dihydro-2H-pyrido[4,3-b]indol-5-yl)methyl]acetamide?
N-[(1-oxo-3,4-dihydro-2H-pyrido[4,3-b]indol-5-yl)methyl]acetamide has a molecular weight of 257.29 g/mol, XLogP of 1.02, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-oxo-3,4-dihydro-2H-pyrido[4,3-b]indol-5-yl)methyl]acetamide is sourced from PubChem (CID 118548633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).