C18H23N3O2 — CID 118123401
N-[4-(2-methyl-1-oxo-3,4-dihydropyrido[4,3-b]indol-5-yl)butyl]acetamide (PubChem CID 118123401) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[4-(2-methyl-1-oxo-3,4-dihydropyrido[4,3-b]indol-5-yl)butyl]acetamide.
| Compound Name | N-[4-(2-methyl-1-oxo-3,4-dihydropyrido[4,3-b]indol-5-yl)butyl]acetamide |
|---|---|
| PubChem CID | 118123401 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-[4-(2-methyl-1-oxo-3,4-dihydropyrido[4,3-b]indol-5-yl)butyl]acetamide |
| SMILES | CC(=O)NCCCCn1c2c(c3ccccc31)C(=O)N(C)CC2 |
| InChI | InChI=1S/C18H23N3O2/c1-13(22)19-10-5-6-11-21-15-8-4-3-7-14(15)17-16(21)9-12-20(2)18(17)23/h3-4,7-8H,5-6,9-12H2,1-2H3,(H,19,22) |
| InChIKey | UPDUOCSIIULEDT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|