C28H41N3O3 — CID 159747048
3-[(4-butylpiperazin-1-yl)methyl]-9-(7-hydroxy-6-oxoheptyl)-2,3-dihydro-1H-carbazol-4-one (PubChem CID 159747048) has the molecular formula C28H41N3O3 and a molecular weight of 467.65 g/mol. Its IUPAC name is 3-[(4-butylpiperazin-1-yl)methyl]-9-(7-hydroxy-6-oxoheptyl)-2,3-dihydro-1H-carbazol-4-one.
| Compound Name | 3-[(4-butylpiperazin-1-yl)methyl]-9-(7-hydroxy-6-oxoheptyl)-2,3-dihydro-1H-carbazol-4-one |
|---|---|
| PubChem CID | 159747048 |
| Molecular Formula | C28H41N3O3 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.31 |
| IUPAC Name | 3-[(4-butylpiperazin-1-yl)methyl]-9-(7-hydroxy-6-oxoheptyl)-2,3-dihydro-1H-carbazol-4-one |
| SMILES | CCCCN1CCN(CC2CCc3c(c4ccccc4n3CCCCCC(=O)CO)C2=O)CC1 |
| InChI | InChI=1S/C28H41N3O3/c1-2-3-14-29-16-18-30(19-17-29)20-22-12-13-26-27(28(22)34)24-10-6-7-11-25(24)31(26)15-8-4-5-9-23(33)21-32/h6-7,10-11,22,32H,2-5,8-9,12-21H2,1H3 |
| InChIKey | NDEAWNQAQOLSCZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|