C15H25NO3 — CID 118550653
[(1S,2E,5R)-5-(2,2-dimethylpropanoyl)-5-methylcyclooct-2-en-1-yl] carbamate (PubChem CID 118550653) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is [(1S,2E,5R)-5-(2,2-dimethylpropanoyl)-5-methylcyclooct-2-en-1-yl] carbamate.
| Compound Name | [(1S,2E,5R)-5-(2,2-dimethylpropanoyl)-5-methylcyclooct-2-en-1-yl] carbamate |
|---|---|
| PubChem CID | 118550653 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | [(1S,2E,5R)-5-(2,2-dimethylpropanoyl)-5-methylcyclooct-2-en-1-yl] carbamate |
| SMILES | CC(C)(C)C(=O)[C@@]1(C)C/C=C\[C@@H](OC(N)=O)CCC1 |
| InChI | InChI=1S/C15H25NO3/c1-14(2,3)12(17)15(4)9-5-7-11(8-6-10-15)19-13(16)18/h5,7,11H,6,8-10H2,1-4H3,(H2,16,18)/b7-5-/t11-,15+/m1/s1 |
| InChIKey | NPJSYSUXKQEPPC-KJAYKDOCSA-N |
| XLogP | 3.20 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|