C20H34O3 — CID 157293658
[(1S,2E,5R)-5-(2,2-dimethylpropanoyl)-5-methylcyclooct-2-en-1-yl] 3,3-dimethylbutanoate (PubChem CID 157293658) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is [(1S,2E,5R)-5-(2,2-dimethylpropanoyl)-5-methylcyclooct-2-en-1-yl] 3,3-dimethylbutanoate.
| Compound Name | [(1S,2E,5R)-5-(2,2-dimethylpropanoyl)-5-methylcyclooct-2-en-1-yl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 157293658 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | [(1S,2E,5R)-5-(2,2-dimethylpropanoyl)-5-methylcyclooct-2-en-1-yl] 3,3-dimethylbutanoate |
| SMILES | CC(C)(C)CC(=O)O[C@@H]1/C=C\C[C@](C)(C(=O)C(C)(C)C)CCC1 |
| InChI | InChI=1S/C20H34O3/c1-18(2,3)14-16(21)23-15-10-8-12-20(7,13-9-11-15)17(22)19(4,5)6/h8,10,15H,9,11-14H2,1-7H3/b10-8-/t15-,20+/m1/s1 |
| InChIKey | SHAFGELFQFNZOH-FSYLJHTJSA-N |
| XLogP | 5.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|