C12H19ClO2 — CID 131871895
[(1R,4S)-4-chlorocyclohept-2-en-1-yl] 2,2-dimethylpropanoate (PubChem CID 131871895) has the molecular formula C12H19ClO2 and a molecular weight of 230.74 g/mol. Its IUPAC name is [(1R,4S)-4-chlorocyclohept-2-en-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1R,4S)-4-chlorocyclohept-2-en-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 131871895 |
| Molecular Formula | C12H19ClO2 |
| Molecular Weight | 230.74 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | [(1R,4S)-4-chlorocyclohept-2-en-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@H]1C=C[C@@H](Cl)CCC1 |
| InChI | InChI=1S/C12H19ClO2/c1-12(2,3)11(14)15-10-6-4-5-9(13)7-8-10/h7-10H,4-6H2,1-3H3/t9-,10+/m0/s1 |
| InChIKey | BVZUCKTZRWRPMV-VHSXEESVSA-N |
| XLogP | 3.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.74 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|