C17H29NO2 — CID 146660261
[1-(2-methylcyclohexyl)-3,6-dihydro-2H-pyridin-3-yl] 2,2-dimethylpropanoate (PubChem CID 146660261) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is [1-(2-methylcyclohexyl)-3,6-dihydro-2H-pyridin-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [1-(2-methylcyclohexyl)-3,6-dihydro-2H-pyridin-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 146660261 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | [1-(2-methylcyclohexyl)-3,6-dihydro-2H-pyridin-3-yl] 2,2-dimethylpropanoate |
| SMILES | CC1CCCCC1N1CC=CC(OC(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C17H29NO2/c1-13-8-5-6-10-15(13)18-11-7-9-14(12-18)20-16(19)17(2,3)4/h7,9,13-15H,5-6,8,10-12H2,1-4H3 |
| InChIKey | AGMWXWFJULDETC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|