C14H23NO2S — CID 146627832
[1-(thiolan-3-yl)-3,6-dihydro-2H-pyridin-3-yl] 2,2-dimethylpropanoate (PubChem CID 146627832) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is [1-(thiolan-3-yl)-3,6-dihydro-2H-pyridin-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [1-(thiolan-3-yl)-3,6-dihydro-2H-pyridin-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 146627832 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | [1-(thiolan-3-yl)-3,6-dihydro-2H-pyridin-3-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC1C=CCN(C2CCSC2)C1 |
| InChI | InChI=1S/C14H23NO2S/c1-14(2,3)13(16)17-12-5-4-7-15(9-12)11-6-8-18-10-11/h4-5,11-12H,6-10H2,1-3H3 |
| InChIKey | SXMSXWBDTKOYEZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|