C15H18N2O2 — CID 134867014
cyclohex-2-en-1-yl 4,4-dicyano-2,2,3-trimethylbut-3-enoate (PubChem CID 134867014) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is cyclohex-2-en-1-yl 4,4-dicyano-2,2,3-trimethylbut-3-enoate.
| Compound Name | cyclohex-2-en-1-yl 4,4-dicyano-2,2,3-trimethylbut-3-enoate |
|---|---|
| PubChem CID | 134867014 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | cyclohex-2-en-1-yl 4,4-dicyano-2,2,3-trimethylbut-3-enoate |
| SMILES | CC(=C(C#N)C#N)C(C)(C)C(=O)OC1C=CCCC1 |
| InChI | InChI=1S/C15H18N2O2/c1-11(12(9-16)10-17)15(2,3)14(18)19-13-7-5-4-6-8-13/h5,7,13H,4,6,8H2,1-3H3 |
| InChIKey | HJLDEEKTNMOHSJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|