C28H25N3O3 — CID 118552169
5-[6-(4-morpholin-4-ylphenyl)-7H-cyclopenta[b]pyridin-4-yl]-2-(oxetan-3-yloxy)benzonitrile (PubChem CID 118552169) has the molecular formula C28H25N3O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is 5-[6-(4-morpholin-4-ylphenyl)-7H-cyclopenta[b]pyridin-4-yl]-2-(oxetan-3-yloxy)benzonitrile.
| Compound Name | 5-[6-(4-morpholin-4-ylphenyl)-7H-cyclopenta[b]pyridin-4-yl]-2-(oxetan-3-yloxy)benzonitrile |
|---|---|
| PubChem CID | 118552169 |
| Molecular Formula | C28H25N3O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 5-[6-(4-morpholin-4-ylphenyl)-7H-cyclopenta[b]pyridin-4-yl]-2-(oxetan-3-yloxy)benzonitrile |
| SMILES | N#Cc1cc(-c2ccnc3c2C=C(c2ccc(N4CCOCC4)cc2)C3)ccc1OC1COC1 |
| InChI | InChI=1S/C28H25N3O3/c29-16-22-13-20(3-6-28(22)34-24-17-33-18-24)25-7-8-30-27-15-21(14-26(25)27)19-1-4-23(5-2-19)31-9-11-32-12-10-31/h1-8,13-14,24H,9-12,15,17-18H2 |
| InChIKey | IMXBHTWMSPWVJH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 67.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|