C30H32N4O3 — CID 118563775
5-[3-ethenyl-2-[(4-morpholin-4-ylphenyl)methylamino]-4-pyridinyl]-2-(oxan-4-yloxy)benzonitrile (PubChem CID 118563775) has the molecular formula C30H32N4O3 and a molecular weight of 496.61 g/mol. Its IUPAC name is 5-[3-ethenyl-2-[(4-morpholin-4-ylphenyl)methylamino]-4-pyridinyl]-2-(oxan-4-yloxy)benzonitrile.
| Compound Name | 5-[3-ethenyl-2-[(4-morpholin-4-ylphenyl)methylamino]-4-pyridinyl]-2-(oxan-4-yloxy)benzonitrile |
|---|---|
| PubChem CID | 118563775 |
| Molecular Formula | C30H32N4O3 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 5-[3-ethenyl-2-[(4-morpholin-4-ylphenyl)methylamino]-4-pyridinyl]-2-(oxan-4-yloxy)benzonitrile |
| SMILES | C=Cc1c(-c2ccc(OC3CCOCC3)c(C#N)c2)ccnc1NCc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C30H32N4O3/c1-2-27-28(23-5-8-29(24(19-23)20-31)37-26-10-15-35-16-11-26)9-12-32-30(27)33-21-22-3-6-25(7-4-22)34-13-17-36-18-14-34/h2-9,12,19,26H,1,10-11,13-18,21H2,(H,32,33) |
| InChIKey | HSRXUOXCVMFOQE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 79.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|