C34H40N6O3 — CID 144973314
2-(dimethylamino)acetaldehyde;5-[3-ethynyl-2-[(4-morpholin-4-ylphenyl)methylamino]-4-pyridinyl]-2-(1-methylpyrrolidin-3-yl)oxybenzonitrile (PubChem CID 144973314) has the molecular formula C34H40N6O3 and a molecular weight of 580.73 g/mol. Its IUPAC name is 2-(dimethylamino)acetaldehyde;5-[3-ethynyl-2-[(4-morpholin-4-ylphenyl)methylamino]-4-pyridinyl]-2-(1-methylpyrrolidin-3-yl)oxybenzonitrile.
| Compound Name | 2-(dimethylamino)acetaldehyde;5-[3-ethynyl-2-[(4-morpholin-4-ylphenyl)methylamino]-4-pyridinyl]-2-(1-methylpyrrolidin-3-yl)oxybenzonitrile |
|---|---|
| PubChem CID | 144973314 |
| Molecular Formula | C34H40N6O3 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.32 |
| IUPAC Name | 2-(dimethylamino)acetaldehyde;5-[3-ethynyl-2-[(4-morpholin-4-ylphenyl)methylamino]-4-pyridinyl]-2-(1-methylpyrrolidin-3-yl)oxybenzonitrile |
| SMILES | C#Cc1c(-c2ccc(OC3CCN(C)C3)c(C#N)c2)ccnc1NCc1ccc(N2CCOCC2)cc1.CN(C)CC=O |
| InChI | InChI=1S/C30H31N5O2.C4H9NO/c1-3-27-28(23-6-9-29(24(18-23)19-31)37-26-11-13-34(2)21-26)10-12-32-30(27)33-20-22-4-7-25(8-5-22)35-14-16-36-17-15-35;1-5(2)3-4-6/h1,4-10,12,18,26H,11,13-17,20-21H2,2H3,(H,32,33);4H,3H2,1-2H3 |
| InChIKey | ZCKYAPYNYLIMON-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|