C22H23ClN2O3 — CID 11855647
2-chloro-4-(3,3-dimethylbut-1-ynyl)-N-[(3R)-3-(hydroxymethyl)-3,4-dihydro-2H-1,4-benzoxazin-7-yl]benzamide (PubChem CID 11855647) has the molecular formula C22H23ClN2O3 and a molecular weight of 398.89 g/mol. Its IUPAC name is 2-chloro-4-(3,3-dimethylbut-1-ynyl)-N-[(3R)-3-(hydroxymethyl)-3,4-dihydro-2H-1,4-benzoxazin-7-yl]benzamide.
| Compound Name | 2-chloro-4-(3,3-dimethylbut-1-ynyl)-N-[(3R)-3-(hydroxymethyl)-3,4-dihydro-2H-1,4-benzoxazin-7-yl]benzamide |
|---|---|
| PubChem CID | 11855647 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 2-chloro-4-(3,3-dimethylbut-1-ynyl)-N-[(3R)-3-(hydroxymethyl)-3,4-dihydro-2H-1,4-benzoxazin-7-yl]benzamide |
| SMILES | CC(C)(C)C#Cc1ccc(C(=O)Nc2ccc3c(c2)OC[C@@H](CO)N3)c(Cl)c1 |
| InChI | InChI=1S/C22H23ClN2O3/c1-22(2,3)9-8-14-4-6-17(18(23)10-14)21(27)25-15-5-7-19-20(11-15)28-13-16(12-26)24-19/h4-7,10-11,16,24,26H,12-13H2,1-3H3,(H,25,27)/t16-/m1/s1 |
| InChIKey | RUELBWUDNVBKJL-MRXNPFEDSA-N |
| XLogP | 4.16 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|