C19H23FN6O2 — CID 118557262
5-(cyclopentylmethyl)-N-[(3S)-6-fluoro-8-methyl-4-oxo-1,2,3,5-tetrahydro-1,5-benzodiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 118557262) has the molecular formula C19H23FN6O2 and a molecular weight of 386.43 g/mol. Its IUPAC name is 5-(cyclopentylmethyl)-N-[(3S)-6-fluoro-8-methyl-4-oxo-1,2,3,5-tetrahydro-1,5-benzodiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-(cyclopentylmethyl)-N-[(3S)-6-fluoro-8-methyl-4-oxo-1,2,3,5-tetrahydro-1,5-benzodiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 118557262 |
| Molecular Formula | C19H23FN6O2 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 5-(cyclopentylmethyl)-N-[(3S)-6-fluoro-8-methyl-4-oxo-1,2,3,5-tetrahydro-1,5-benzodiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1cc(F)c2c(c1)NC[C@H](NC(=O)c1n[nH]c(CC3CCCC3)n1)C(=O)N2 |
| InChI | InChI=1S/C19H23FN6O2/c1-10-6-12(20)16-13(7-10)21-9-14(18(27)24-16)22-19(28)17-23-15(25-26-17)8-11-4-2-3-5-11/h6-7,11,14,21H,2-5,8-9H2,1H3,(H,22,28)(H,24,27)(H,23,25,26)/t14-/m0/s1 |
| InChIKey | BIVWGHCVHMQGSR-AWEZNQCLSA-N |
| XLogP | 2.15 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |