C26H25BrFNO3 — CID 118558018
2-[[3-acetyl-1-[(3-fluorophenyl)methyl]pyridin-1-ium-4-yl]methyl]-6-methoxy-3,4-dihydro-2H-naphthalen-1-one bromide (PubChem CID 118558018) has the molecular formula C26H25BrFNO3 and a molecular weight of 498.39 g/mol. Its IUPAC name is 2-[[3-acetyl-1-[(3-fluorophenyl)methyl]pyridin-1-ium-4-yl]methyl]-6-methoxy-3,4-dihydro-2H-naphthalen-1-one bromide.
| Compound Name | 2-[[3-acetyl-1-[(3-fluorophenyl)methyl]pyridin-1-ium-4-yl]methyl]-6-methoxy-3,4-dihydro-2H-naphthalen-1-one bromide |
|---|---|
| PubChem CID | 118558018 |
| Molecular Formula | C26H25BrFNO3 |
| Molecular Weight | 498.39 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | 2-[[3-acetyl-1-[(3-fluorophenyl)methyl]pyridin-1-ium-4-yl]methyl]-6-methoxy-3,4-dihydro-2H-naphthalen-1-one bromide |
| SMILES | COc1ccc2c(c1)CCC(Cc1cc[n+](Cc3cccc(F)c3)cc1C(C)=O)C2=O.[Br-] |
| InChI | InChI=1S/C26H25FNO3.BrH/c1-17(29)25-16-28(15-18-4-3-5-22(27)12-18)11-10-20(25)13-21-7-6-19-14-23(31-2)8-9-24(19)26(21)30;/h3-5,8-12,14,16,21H,6-7,13,15H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | WHEWDFDDGJOOQU-UHFFFAOYSA-M |
| XLogP | 1.36 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|