C27H28NO2+ — CID 118563611
2-[[3-acetyl-1-[(2-methylphenyl)methyl]pyridin-1-ium-4-yl]methyl]-6-methyl-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 118563611) has the molecular formula C27H28NO2+ and a molecular weight of 398.53 g/mol. Its IUPAC name is 2-[[3-acetyl-1-[(2-methylphenyl)methyl]pyridin-1-ium-4-yl]methyl]-6-methyl-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 2-[[3-acetyl-1-[(2-methylphenyl)methyl]pyridin-1-ium-4-yl]methyl]-6-methyl-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 118563611 |
| Molecular Formula | C27H28NO2+ |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 2-[[3-acetyl-1-[(2-methylphenyl)methyl]pyridin-1-ium-4-yl]methyl]-6-methyl-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CC(=O)c1c[n+](Cc2ccccc2C)ccc1CC1CCc2cc(C)ccc2C1=O |
| InChI | InChI=1S/C27H28NO2/c1-18-8-11-25-21(14-18)9-10-23(27(25)30)15-22-12-13-28(17-26(22)20(3)29)16-24-7-5-4-6-19(24)2/h4-8,11-14,17,23H,9-10,15-16H2,1-3H3/q+1 |
| InChIKey | YCFZFXYAGROMPF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 38.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|