C22H22BrNO3 — CID 118558145
methyl 5-(2-benzyl-6-bromo-1-oxoisoquinolin-3-yl)pentanoate (PubChem CID 118558145) has the molecular formula C22H22BrNO3 and a molecular weight of 428.33 g/mol. Its IUPAC name is methyl 5-(2-benzyl-6-bromo-1-oxoisoquinolin-3-yl)pentanoate.
| Compound Name | methyl 5-(2-benzyl-6-bromo-1-oxoisoquinolin-3-yl)pentanoate |
|---|---|
| PubChem CID | 118558145 |
| Molecular Formula | C22H22BrNO3 |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | methyl 5-(2-benzyl-6-bromo-1-oxoisoquinolin-3-yl)pentanoate |
| SMILES | COC(=O)CCCCc1cc2cc(Br)ccc2c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C22H22BrNO3/c1-27-21(25)10-6-5-9-19-14-17-13-18(23)11-12-20(17)22(26)24(19)15-16-7-3-2-4-8-16/h2-4,7-8,11-14H,5-6,9-10,15H2,1H3 |
| InChIKey | GRCIHHFDEPLZFW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|