C18H18N4OS — CID 118559411
1-[3-[2-amino-6-(2-phenylethylamino)pyrimidin-4-yl]thiophen-2-yl]ethanone (PubChem CID 118559411) has the molecular formula C18H18N4OS and a molecular weight of 338.44 g/mol. Its IUPAC name is 1-[3-[2-amino-6-(2-phenylethylamino)pyrimidin-4-yl]thiophen-2-yl]ethanone.
| Compound Name | 1-[3-[2-amino-6-(2-phenylethylamino)pyrimidin-4-yl]thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 118559411 |
| Molecular Formula | C18H18N4OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 1-[3-[2-amino-6-(2-phenylethylamino)pyrimidin-4-yl]thiophen-2-yl]ethanone |
| SMILES | CC(=O)c1sccc1-c1cc(NCCc2ccccc2)nc(N)n1 |
| InChI | InChI=1S/C18H18N4OS/c1-12(23)17-14(8-10-24-17)15-11-16(22-18(19)21-15)20-9-7-13-5-3-2-4-6-13/h2-6,8,10-11H,7,9H2,1H3,(H3,19,20,21,22) |
| InChIKey | WOYZQVRBRLGKOO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |