C21H25ClN4S — CID 118567977
4-(3-chloro-2-methylphenyl)-6-N-[2-(2-phenylethylsulfanyl)ethyl]-1,4-dihydropyrimidine-2,6-diamine (PubChem CID 118567977) has the molecular formula C21H25ClN4S and a molecular weight of 400.98 g/mol. Its IUPAC name is 4-(3-chloro-2-methylphenyl)-6-N-[2-(2-phenylethylsulfanyl)ethyl]-1,4-dihydropyrimidine-2,6-diamine.
| Compound Name | 4-(3-chloro-2-methylphenyl)-6-N-[2-(2-phenylethylsulfanyl)ethyl]-1,4-dihydropyrimidine-2,6-diamine |
|---|---|
| PubChem CID | 118567977 |
| Molecular Formula | C21H25ClN4S |
| Molecular Weight | 400.98 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 4-(3-chloro-2-methylphenyl)-6-N-[2-(2-phenylethylsulfanyl)ethyl]-1,4-dihydropyrimidine-2,6-diamine |
| SMILES | Cc1c(Cl)cccc1C1C=C(NCCSCCc2ccccc2)NC(N)=N1 |
| InChI | InChI=1S/C21H25ClN4S/c1-15-17(8-5-9-18(15)22)19-14-20(26-21(23)25-19)24-11-13-27-12-10-16-6-3-2-4-7-16/h2-9,14,19,24H,10-13H2,1H3,(H3,23,25,26) |
| InChIKey | KGBWSZDDLBRABV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.98 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|