C16H25N5OS — CID 118568137
N-[3-[[2-amino-4-(2,3-dimethylphenyl)-1,4-dihydropyrimidin-6-yl]amino]propyl]methanesulfinimidic acid (PubChem CID 118568137) has the molecular formula C16H25N5OS and a molecular weight of 335.48 g/mol. Its IUPAC name is N-[3-[[2-amino-4-(2,3-dimethylphenyl)-1,4-dihydropyrimidin-6-yl]amino]propyl]methanesulfinimidic acid.
| Compound Name | N-[3-[[2-amino-4-(2,3-dimethylphenyl)-1,4-dihydropyrimidin-6-yl]amino]propyl]methanesulfinimidic acid |
|---|---|
| PubChem CID | 118568137 |
| Molecular Formula | C16H25N5OS |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | N-[3-[[2-amino-4-(2,3-dimethylphenyl)-1,4-dihydropyrimidin-6-yl]amino]propyl]methanesulfinimidic acid |
| SMILES | Cc1cccc(C2C=C(NCCC/N=S(\C)O)NC(N)=N2)c1C |
| InChI | InChI=1S/C16H25N5OS/c1-11-6-4-7-13(12(11)2)14-10-15(21-16(17)20-14)18-8-5-9-19-23(3)22/h4,6-7,10,14,18H,5,8-9H2,1-3H3,(H,19,22)(H3,17,20,21) |
| InChIKey | UOZXZKDNLHKDCU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 95.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|