C35H41N3O2 — CID 118572854
[(3S,8R,9S,10R,13S,14S)-16-(anilinomethyl)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 118572854) has the molecular formula C35H41N3O2 and a molecular weight of 535.73 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S)-16-(anilinomethyl)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8R,9S,10R,13S,14S)-16-(anilinomethyl)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 118572854 |
| Molecular Formula | C35H41N3O2 |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.32 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S)-16-(anilinomethyl)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C(n4cnc5ccccc54)=C(CNc4ccccc4)C[C@@H]32)C1 |
| InChI | InChI=1S/C35H41N3O2/c1-23(39)40-27-15-17-34(2)25(20-27)13-14-28-29(34)16-18-35(3)30(28)19-24(21-36-26-9-5-4-6-10-26)33(35)38-22-37-31-11-7-8-12-32(31)38/h4-13,22,27-30,36H,14-21H2,1-3H3/t27-,28+,29-,30-,34-,35-/m0/s1 |
| InChIKey | GVPKDXALYLOQGA-OMTOIWJMSA-N |
| XLogP | 7.86 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|