C19H19NO2 — CID 11857458
[(2S,5R)-5-(5-phenylindol-1-yl)oxolan-2-yl]methanol (PubChem CID 11857458) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is [(2S,5R)-5-(5-phenylindol-1-yl)oxolan-2-yl]methanol.
| Compound Name | [(2S,5R)-5-(5-phenylindol-1-yl)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 11857458 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | [(2S,5R)-5-(5-phenylindol-1-yl)oxolan-2-yl]methanol |
| SMILES | OC[C@@H]1CC[C@H](n2ccc3cc(-c4ccccc4)ccc32)O1 |
| InChI | InChI=1S/C19H19NO2/c21-13-17-7-9-19(22-17)20-11-10-16-12-15(6-8-18(16)20)14-4-2-1-3-5-14/h1-6,8,10-12,17,19,21H,7,9,13H2/t17-,19+/m0/s1 |
| InChIKey | QNAJLPPLJMAQKU-PKOBYXMFSA-N |
| XLogP | 3.98 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |