C28H28N2O9S — CID 118580385
1-[4-(3-hydroxy-6-oxoxanthen-9-yl)phenyl]-3-[2-[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]thiourea (PubChem CID 118580385) has the molecular formula C28H28N2O9S and a molecular weight of 568.60 g/mol. Its IUPAC name is 1-[4-(3-hydroxy-6-oxoxanthen-9-yl)phenyl]-3-[2-[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]thiourea.
| Compound Name | 1-[4-(3-hydroxy-6-oxoxanthen-9-yl)phenyl]-3-[2-[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]thiourea |
|---|---|
| PubChem CID | 118580385 |
| Molecular Formula | C28H28N2O9S |
| Molecular Weight | 568.60 g/mol |
| Exact Mass | 568.15 |
| IUPAC Name | 1-[4-(3-hydroxy-6-oxoxanthen-9-yl)phenyl]-3-[2-[(2S,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]thiourea |
| SMILES | O=c1ccc2c(-c3ccc(NC(=S)NCCO[C@H]4OC(CO)[C@@H](O)[C@H](O)C4O)cc3)c3ccc(O)cc3oc-2c1 |
| InChI | InChI=1S/C28H28N2O9S/c31-13-22-24(34)25(35)26(36)27(39-22)37-10-9-29-28(40)30-15-3-1-14(2-4-15)23-18-7-5-16(32)11-20(18)38-21-12-17(33)6-8-19(21)23/h1-8,11-12,22,24-27,31-32,34-36H,9-10,13H2,(H2,29,30,40)/t22?,24-,25+,26?,27+/m1/s1 |
| InChIKey | SNEAWMVKSUVDOT-LRSMYOASSA-N |
| XLogP | 1.37 |
| TPSA | 173.88 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.60 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|