C23H23N3O3S — CID 143607705
ethane;1-[4-(3-hydroxy-6-oxoxanthen-9-yl)phenyl]-3-(methylamino)thiourea (PubChem CID 143607705) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is ethane;1-[4-(3-hydroxy-6-oxoxanthen-9-yl)phenyl]-3-(methylamino)thiourea.
| Compound Name | ethane;1-[4-(3-hydroxy-6-oxoxanthen-9-yl)phenyl]-3-(methylamino)thiourea |
|---|---|
| PubChem CID | 143607705 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | ethane;1-[4-(3-hydroxy-6-oxoxanthen-9-yl)phenyl]-3-(methylamino)thiourea |
| SMILES | CC.CNNC(=S)Nc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C21H17N3O3S.C2H6/c1-22-24-21(28)23-13-4-2-12(3-5-13)20-16-8-6-14(25)10-18(16)27-19-11-15(26)7-9-17(19)20;1-2/h2-11,22,25H,1H3,(H2,23,24,28);1-2H3 |
| InChIKey | VXEZQPYZZHNVFN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 86.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|