C14H13N3O6S2 — CID 118581465
2-(3-ethylsulfonyl-1-oxidopyridin-1-ium-2-yl)-6-methylsulfonyl-[1,3]oxazolo[5,4-b]pyridine (PubChem CID 118581465) has the molecular formula C14H13N3O6S2 and a molecular weight of 383.41 g/mol. Its IUPAC name is 2-(3-ethylsulfonyl-1-oxidopyridin-1-ium-2-yl)-6-methylsulfonyl-[1,3]oxazolo[5,4-b]pyridine.
| Compound Name | 2-(3-ethylsulfonyl-1-oxidopyridin-1-ium-2-yl)-6-methylsulfonyl-[1,3]oxazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 118581465 |
| Molecular Formula | C14H13N3O6S2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | 2-(3-ethylsulfonyl-1-oxidopyridin-1-ium-2-yl)-6-methylsulfonyl-[1,3]oxazolo[5,4-b]pyridine |
| SMILES | CCS(=O)(=O)c1ccc[n+]([O-])c1-c1nc2cc(S(C)(=O)=O)cnc2o1 |
| InChI | InChI=1S/C14H13N3O6S2/c1-3-25(21,22)11-5-4-6-17(18)12(11)14-16-10-7-9(24(2,19)20)8-15-13(10)23-14/h4-8H,3H2,1-2H3 |
| InChIKey | IMJJTZFGHKRLRB-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 134.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|