C16H13F3N4O3S — CID 126720622
3-ethylsulfonyl-1-oxido-2-[1-[4-(trifluoromethyl)phenyl]triazol-4-yl]pyridin-1-ium (PubChem CID 126720622) has the molecular formula C16H13F3N4O3S and a molecular weight of 398.37 g/mol. Its IUPAC name is 3-ethylsulfonyl-1-oxido-2-[1-[4-(trifluoromethyl)phenyl]triazol-4-yl]pyridin-1-ium.
| Compound Name | 3-ethylsulfonyl-1-oxido-2-[1-[4-(trifluoromethyl)phenyl]triazol-4-yl]pyridin-1-ium |
|---|---|
| PubChem CID | 126720622 |
| Molecular Formula | C16H13F3N4O3S |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 3-ethylsulfonyl-1-oxido-2-[1-[4-(trifluoromethyl)phenyl]triazol-4-yl]pyridin-1-ium |
| SMILES | CCS(=O)(=O)c1ccc[n+]([O-])c1-c1cn(-c2ccc(C(F)(F)F)cc2)nn1 |
| InChI | InChI=1S/C16H13F3N4O3S/c1-2-27(25,26)14-4-3-9-23(24)15(14)13-10-22(21-20-13)12-7-5-11(6-8-12)16(17,18)19/h3-10H,2H2,1H3 |
| InChIKey | ZPRTUODQHVBOSV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|