C16H14N2O5S2 — CID 163580805
5-methylsulfonyl-2-(3-prop-2-enylsulfonyl-2-pyridinyl)-1,3-benzoxazole (PubChem CID 163580805) has the molecular formula C16H14N2O5S2 and a molecular weight of 378.43 g/mol. Its IUPAC name is 5-methylsulfonyl-2-(3-prop-2-enylsulfonyl-2-pyridinyl)-1,3-benzoxazole.
| Compound Name | 5-methylsulfonyl-2-(3-prop-2-enylsulfonyl-2-pyridinyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 163580805 |
| Molecular Formula | C16H14N2O5S2 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | 5-methylsulfonyl-2-(3-prop-2-enylsulfonyl-2-pyridinyl)-1,3-benzoxazole |
| SMILES | C=CCS(=O)(=O)c1cccnc1-c1nc2cc(S(C)(=O)=O)ccc2o1 |
| InChI | InChI=1S/C16H14N2O5S2/c1-3-9-25(21,22)14-5-4-8-17-15(14)16-18-12-10-11(24(2,19)20)6-7-13(12)23-16/h3-8,10H,1,9H2,2H3 |
| InChIKey | GHJJJPDQWLBUQQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 107.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|