C25H42O — CID 118583702
3-propyl-6-[4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexyl]-3,4-dihydro-2H-pyran (PubChem CID 118583702) has the molecular formula C25H42O and a molecular weight of 358.61 g/mol. Its IUPAC name is 3-propyl-6-[4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexyl]-3,4-dihydro-2H-pyran.
| Compound Name | 3-propyl-6-[4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexyl]-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 118583702 |
| Molecular Formula | C25H42O |
| Molecular Weight | 358.61 g/mol |
| Exact Mass | 358.32 |
| IUPAC Name | 3-propyl-6-[4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexyl]-3,4-dihydro-2H-pyran |
| SMILES | CCCC1CCC(/C=C/C2CCC(C3=CCC(CCC)CO3)CC2)CC1 |
| InChI | InChI=1S/C25H42O/c1-3-5-20-7-9-21(10-8-20)11-12-22-13-16-24(17-14-22)25-18-15-23(6-4-2)19-26-25/h11-12,18,20-24H,3-10,13-17,19H2,1-2H3/b12-11+ |
| InChIKey | KMNFJYAKKFTMRR-VAWYXSNFSA-N |
| XLogP | 7.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.61 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|