C19H34N2S — CID 118585002
N-(3-benzylsulfanylpropyl)-N'-butyl-N'-ethylpropane-1,3-diamine (PubChem CID 118585002) has the molecular formula C19H34N2S and a molecular weight of 322.56 g/mol. Its IUPAC name is N-(3-benzylsulfanylpropyl)-N'-butyl-N'-ethylpropane-1,3-diamine.
| Compound Name | N-(3-benzylsulfanylpropyl)-N'-butyl-N'-ethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 118585002 |
| Molecular Formula | C19H34N2S |
| Molecular Weight | 322.56 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | N-(3-benzylsulfanylpropyl)-N'-butyl-N'-ethylpropane-1,3-diamine |
| SMILES | CCCCN(CC)CCCNCCCSCc1ccccc1 |
| InChI | InChI=1S/C19H34N2S/c1-3-5-15-21(4-2)16-9-13-20-14-10-17-22-18-19-11-7-6-8-12-19/h6-8,11-12,20H,3-5,9-10,13-18H2,1-2H3 |
| InChIKey | KKKDNHOGONQAPF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|