C19H34N2S — CID 118585259
N-(2-benzylsulfanylethyl)-N'-butyl-N'-tert-butylethane-1,2-diamine (PubChem CID 118585259) has the molecular formula C19H34N2S and a molecular weight of 322.56 g/mol. Its IUPAC name is N-(2-benzylsulfanylethyl)-N'-butyl-N'-tert-butylethane-1,2-diamine.
| Compound Name | N-(2-benzylsulfanylethyl)-N'-butyl-N'-tert-butylethane-1,2-diamine |
|---|---|
| PubChem CID | 118585259 |
| Molecular Formula | C19H34N2S |
| Molecular Weight | 322.56 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | N-(2-benzylsulfanylethyl)-N'-butyl-N'-tert-butylethane-1,2-diamine |
| SMILES | CCCCN(CCNCCSCc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C19H34N2S/c1-5-6-14-21(19(2,3)4)15-12-20-13-16-22-17-18-10-8-7-9-11-18/h7-11,20H,5-6,12-17H2,1-4H3 |
| InChIKey | NQEAVQDMSMYXDA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|