C20H28N2S — CID 118585186
N'-benzyl-N-(2-benzylsulfanylethyl)-N'-ethylethane-1,2-diamine (PubChem CID 118585186) has the molecular formula C20H28N2S and a molecular weight of 328.53 g/mol. Its IUPAC name is N'-benzyl-N-(2-benzylsulfanylethyl)-N'-ethylethane-1,2-diamine.
| Compound Name | N'-benzyl-N-(2-benzylsulfanylethyl)-N'-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 118585186 |
| Molecular Formula | C20H28N2S |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | N'-benzyl-N-(2-benzylsulfanylethyl)-N'-ethylethane-1,2-diamine |
| SMILES | CCN(CCNCCSCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C20H28N2S/c1-2-22(17-19-9-5-3-6-10-19)15-13-21-14-16-23-18-20-11-7-4-8-12-20/h3-12,21H,2,13-18H2,1H3 |
| InChIKey | BPAKSYUPVAAZCQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|