C18H24N2S — CID 118584731
N-(2-benzylsulfanylethyl)-N'-methyl-N'-phenylethane-1,2-diamine (PubChem CID 118584731) has the molecular formula C18H24N2S and a molecular weight of 300.47 g/mol. Its IUPAC name is N-(2-benzylsulfanylethyl)-N'-methyl-N'-phenylethane-1,2-diamine.
| Compound Name | N-(2-benzylsulfanylethyl)-N'-methyl-N'-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 118584731 |
| Molecular Formula | C18H24N2S |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | N-(2-benzylsulfanylethyl)-N'-methyl-N'-phenylethane-1,2-diamine |
| SMILES | CN(CCNCCSCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H24N2S/c1-20(18-10-6-3-7-11-18)14-12-19-13-15-21-16-17-8-4-2-5-9-17/h2-11,19H,12-16H2,1H3 |
| InChIKey | NIIBSSJXDWLKFR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|