C20H28N2S — CID 118585144
N'-(2-benzylsulfanylethyl)-N,N-dimethyl-N'-phenylpropane-1,3-diamine (PubChem CID 118585144) has the molecular formula C20H28N2S and a molecular weight of 328.53 g/mol. Its IUPAC name is N'-(2-benzylsulfanylethyl)-N,N-dimethyl-N'-phenylpropane-1,3-diamine.
| Compound Name | N'-(2-benzylsulfanylethyl)-N,N-dimethyl-N'-phenylpropane-1,3-diamine |
|---|---|
| PubChem CID | 118585144 |
| Molecular Formula | C20H28N2S |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | N'-(2-benzylsulfanylethyl)-N,N-dimethyl-N'-phenylpropane-1,3-diamine |
| SMILES | CN(C)CCCN(CCSCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H28N2S/c1-21(2)14-9-15-22(20-12-7-4-8-13-20)16-17-23-18-19-10-5-3-6-11-19/h3-8,10-13H,9,14-18H2,1-2H3 |
| InChIKey | NUPHGSJTLGYPHJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|