C18H31NS4 — CID 15768982
N,N-bis[2-(2-ethylsulfanylethylsulfanyl)ethyl]aniline (PubChem CID 15768982) has the molecular formula C18H31NS4 and a molecular weight of 389.72 g/mol. Its IUPAC name is N,N-bis[2-(2-ethylsulfanylethylsulfanyl)ethyl]aniline.
| Compound Name | N,N-bis[2-(2-ethylsulfanylethylsulfanyl)ethyl]aniline |
|---|---|
| PubChem CID | 15768982 |
| Molecular Formula | C18H31NS4 |
| Molecular Weight | 389.72 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | N,N-bis[2-(2-ethylsulfanylethylsulfanyl)ethyl]aniline |
| SMILES | CCSCCSCCN(CCSCCSCC)c1ccccc1 |
| InChI | InChI=1S/C18H31NS4/c1-3-20-14-16-22-12-10-19(18-8-6-5-7-9-18)11-13-23-17-15-21-4-2/h5-9H,3-4,10-17H2,1-2H3 |
| InChIKey | GFVQWIWXDUGCKM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.72 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|