C19H32N2S — CID 118585253
N-(2-benzylsulfanylethyl)-N'-cyclopentyl-N'-propylethane-1,2-diamine (PubChem CID 118585253) has the molecular formula C19H32N2S and a molecular weight of 320.55 g/mol. Its IUPAC name is N-(2-benzylsulfanylethyl)-N'-cyclopentyl-N'-propylethane-1,2-diamine.
| Compound Name | N-(2-benzylsulfanylethyl)-N'-cyclopentyl-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 118585253 |
| Molecular Formula | C19H32N2S |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | N-(2-benzylsulfanylethyl)-N'-cyclopentyl-N'-propylethane-1,2-diamine |
| SMILES | CCCN(CCNCCSCc1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C19H32N2S/c1-2-14-21(19-10-6-7-11-19)15-12-20-13-16-22-17-18-8-4-3-5-9-18/h3-5,8-9,19-20H,2,6-7,10-17H2,1H3 |
| InChIKey | ULFPYQGTYCTCJL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|