C18H17NO2S — CID 11858583
ethyl 2-phenyl-3,5-dihydro-4,1-benzothiazepine-3-carboxylate (PubChem CID 11858583) has the molecular formula C18H17NO2S and a molecular weight of 311.41 g/mol. Its IUPAC name is ethyl 2-phenyl-3,5-dihydro-4,1-benzothiazepine-3-carboxylate.
| Compound Name | ethyl 2-phenyl-3,5-dihydro-4,1-benzothiazepine-3-carboxylate |
|---|---|
| PubChem CID | 11858583 |
| Molecular Formula | C18H17NO2S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | ethyl 2-phenyl-3,5-dihydro-4,1-benzothiazepine-3-carboxylate |
| SMILES | CCOC(=O)C1SCc2ccccc2N=C1c1ccccc1 |
| InChI | InChI=1S/C18H17NO2S/c1-2-21-18(20)17-16(13-8-4-3-5-9-13)19-15-11-7-6-10-14(15)12-22-17/h3-11,17H,2,12H2,1H3 |
| InChIKey | BLXMGNBFLWOLKN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |