C26H24N4O6 — CID 118586065
4-[5-(4-cyanobutoxy)-1-benzofuran-2-yl]-4-oxo-2-[2-(4-oxo-1,2,3-benzotriazin-3-yl)ethyl]butanoic acid (PubChem CID 118586065) has the molecular formula C26H24N4O6 and a molecular weight of 488.50 g/mol. Its IUPAC name is 4-[5-(4-cyanobutoxy)-1-benzofuran-2-yl]-4-oxo-2-[2-(4-oxo-1,2,3-benzotriazin-3-yl)ethyl]butanoic acid.
| Compound Name | 4-[5-(4-cyanobutoxy)-1-benzofuran-2-yl]-4-oxo-2-[2-(4-oxo-1,2,3-benzotriazin-3-yl)ethyl]butanoic acid |
|---|---|
| PubChem CID | 118586065 |
| Molecular Formula | C26H24N4O6 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 4-[5-(4-cyanobutoxy)-1-benzofuran-2-yl]-4-oxo-2-[2-(4-oxo-1,2,3-benzotriazin-3-yl)ethyl]butanoic acid |
| SMILES | N#CCCCCOc1ccc2oc(C(=O)CC(CCn3nnc4ccccc4c3=O)C(=O)O)cc2c1 |
| InChI | InChI=1S/C26H24N4O6/c27-11-4-1-5-13-35-19-8-9-23-18(14-19)16-24(36-23)22(31)15-17(26(33)34)10-12-30-25(32)20-6-2-3-7-21(20)28-29-30/h2-3,6-9,14,16-17H,1,4-5,10,12-13,15H2,(H,33,34) |
| InChIKey | RZNLBIBIZHLZEJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|