C27H37F3O2 — CID 118594181
2-[4-[4-(4-ethylcyclohexyl)-2,3-difluorophenyl]cyclohexen-1-yl]-5-fluoro-5-propyl-1,3-dioxane (PubChem CID 118594181) has the molecular formula C27H37F3O2 and a molecular weight of 450.59 g/mol. Its IUPAC name is 2-[4-[4-(4-ethylcyclohexyl)-2,3-difluorophenyl]cyclohexen-1-yl]-5-fluoro-5-propyl-1,3-dioxane.
| Compound Name | 2-[4-[4-(4-ethylcyclohexyl)-2,3-difluorophenyl]cyclohexen-1-yl]-5-fluoro-5-propyl-1,3-dioxane |
|---|---|
| PubChem CID | 118594181 |
| Molecular Formula | C27H37F3O2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | 2-[4-[4-(4-ethylcyclohexyl)-2,3-difluorophenyl]cyclohexen-1-yl]-5-fluoro-5-propyl-1,3-dioxane |
| SMILES | CCCC1(F)COC(C2=CCC(c3ccc(C4CCC(CC)CC4)c(F)c3F)CC2)OC1 |
| InChI | InChI=1S/C27H37F3O2/c1-3-15-27(30)16-31-26(32-17-27)21-11-9-20(10-12-21)23-14-13-22(24(28)25(23)29)19-7-5-18(4-2)6-8-19/h11,13-14,18-20,26H,3-10,12,15-17H2,1-2H3 |
| InChIKey | BFRSMVKNXQHXLF-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|