C16H16ClN3O5 — CID 118599554
(2S)-2-[[3-(4-chlorobenzoyl)-1-methylpyrazol-4-yl]amino]-4-methoxy-4-oxobutanoic acid (PubChem CID 118599554) has the molecular formula C16H16ClN3O5 and a molecular weight of 365.77 g/mol. Its IUPAC name is (2S)-2-[[3-(4-chlorobenzoyl)-1-methylpyrazol-4-yl]amino]-4-methoxy-4-oxobutanoic acid.
| Compound Name | (2S)-2-[[3-(4-chlorobenzoyl)-1-methylpyrazol-4-yl]amino]-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 118599554 |
| Molecular Formula | C16H16ClN3O5 |
| Molecular Weight | 365.77 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | (2S)-2-[[3-(4-chlorobenzoyl)-1-methylpyrazol-4-yl]amino]-4-methoxy-4-oxobutanoic acid |
| SMILES | COC(=O)C[C@H](Nc1cn(C)nc1C(=O)c1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C16H16ClN3O5/c1-20-8-12(18-11(16(23)24)7-13(21)25-2)14(19-20)15(22)9-3-5-10(17)6-4-9/h3-6,8,11,18H,7H2,1-2H3,(H,23,24)/t11-/m0/s1 |
| InChIKey | KMWKFECDXFSDKQ-NSHDSACASA-N |
| XLogP | 1.73 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.77 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |