C17H18ClN3O5 — CID 118644791
dimethyl (2S)-2-[[3-(4-chlorobenzoyl)-1-methylpyrazol-4-yl]amino]butanedioate (PubChem CID 118644791) has the molecular formula C17H18ClN3O5 and a molecular weight of 379.80 g/mol. Its IUPAC name is dimethyl (2S)-2-[[3-(4-chlorobenzoyl)-1-methylpyrazol-4-yl]amino]butanedioate.
| Compound Name | dimethyl (2S)-2-[[3-(4-chlorobenzoyl)-1-methylpyrazol-4-yl]amino]butanedioate |
|---|---|
| PubChem CID | 118644791 |
| Molecular Formula | C17H18ClN3O5 |
| Molecular Weight | 379.80 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | dimethyl (2S)-2-[[3-(4-chlorobenzoyl)-1-methylpyrazol-4-yl]amino]butanedioate |
| SMILES | COC(=O)C[C@H](Nc1cn(C)nc1C(=O)c1ccc(Cl)cc1)C(=O)OC |
| InChI | InChI=1S/C17H18ClN3O5/c1-21-9-13(19-12(17(24)26-3)8-14(22)25-2)15(20-21)16(23)10-4-6-11(18)7-5-10/h4-7,9,12,19H,8H2,1-3H3/t12-/m0/s1 |
| InChIKey | FKTOUTWGNYDPAH-LBPRGKRZSA-N |
| XLogP | 1.82 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.80 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |