C16H15ClN3O5- — CID 131745302
(3S)-3-[[3-(4-chlorobenzoyl)-1-methylpyrazol-4-yl]amino]-4-methoxy-4-oxobutanoate (PubChem CID 131745302) has the molecular formula C16H15ClN3O5- and a molecular weight of 364.77 g/mol. Its IUPAC name is (3S)-3-[[3-(4-chlorobenzoyl)-1-methylpyrazol-4-yl]amino]-4-methoxy-4-oxobutanoate.
| Compound Name | (3S)-3-[[3-(4-chlorobenzoyl)-1-methylpyrazol-4-yl]amino]-4-methoxy-4-oxobutanoate |
|---|---|
| PubChem CID | 131745302 |
| Molecular Formula | C16H15ClN3O5- |
| Molecular Weight | 364.77 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | (3S)-3-[[3-(4-chlorobenzoyl)-1-methylpyrazol-4-yl]amino]-4-methoxy-4-oxobutanoate |
| SMILES | COC(=O)[C@H](CC(=O)[O-])Nc1cn(C)nc1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H16ClN3O5/c1-20-8-12(18-11(7-13(21)22)16(24)25-2)14(19-20)15(23)9-3-5-10(17)6-4-9/h3-6,8,11,18H,7H2,1-2H3,(H,21,22)/p-1/t11-/m0/s1 |
| InChIKey | WDEXQKDJWGEBFI-NSHDSACASA-M |
| XLogP | 0.40 |
| TPSA | 113.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.77 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |