C22H26ClN3O — CID 118602696
(7-chloro-2,3,4,5-tetrahydro-1-benzazepin-1-yl)-[4-(4-methylphenyl)piperazin-1-yl]methanone (PubChem CID 118602696) has the molecular formula C22H26ClN3O and a molecular weight of 383.92 g/mol. Its IUPAC name is (7-chloro-2,3,4,5-tetrahydro-1-benzazepin-1-yl)-[4-(4-methylphenyl)piperazin-1-yl]methanone.
| Compound Name | (7-chloro-2,3,4,5-tetrahydro-1-benzazepin-1-yl)-[4-(4-methylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 118602696 |
| Molecular Formula | C22H26ClN3O |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | (7-chloro-2,3,4,5-tetrahydro-1-benzazepin-1-yl)-[4-(4-methylphenyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc(N2CCN(C(=O)N3CCCCc4cc(Cl)ccc43)CC2)cc1 |
| InChI | InChI=1S/C22H26ClN3O/c1-17-5-8-20(9-6-17)24-12-14-25(15-13-24)22(27)26-11-3-2-4-18-16-19(23)7-10-21(18)26/h5-10,16H,2-4,11-15H2,1H3 |
| InChIKey | OBGODJJUORTRLP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|