C16H31N3O — CID 118603482
N-(3-imidazol-1-ylpropyl)-2,2-dimethyl-N-[(2-methylpropan-2-yl)oxymethyl]propan-1-amine (PubChem CID 118603482) has the molecular formula C16H31N3O and a molecular weight of 281.44 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-2,2-dimethyl-N-[(2-methylpropan-2-yl)oxymethyl]propan-1-amine.
| Compound Name | N-(3-imidazol-1-ylpropyl)-2,2-dimethyl-N-[(2-methylpropan-2-yl)oxymethyl]propan-1-amine |
|---|---|
| PubChem CID | 118603482 |
| Molecular Formula | C16H31N3O |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.25 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-2,2-dimethyl-N-[(2-methylpropan-2-yl)oxymethyl]propan-1-amine |
| SMILES | CC(C)(C)CN(CCCn1ccnc1)COC(C)(C)C |
| InChI | InChI=1S/C16H31N3O/c1-15(2,3)12-19(14-20-16(4,5)6)10-7-9-18-11-8-17-13-18/h8,11,13H,7,9-10,12,14H2,1-6H3 |
| InChIKey | NPSKPJXFDFMRSJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|