C12H33N3P6Si2 — CID 162260133
N,N-bis[3-bis(phosphanyl)phosphanylsilylpropyl]-3-imidazol-1-ylpropan-1-amine (PubChem CID 162260133) has the molecular formula C12H33N3P6Si2 and a molecular weight of 461.43 g/mol. Its IUPAC name is N,N-bis[3-bis(phosphanyl)phosphanylsilylpropyl]-3-imidazol-1-ylpropan-1-amine.
| Compound Name | N,N-bis[3-bis(phosphanyl)phosphanylsilylpropyl]-3-imidazol-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 162260133 |
| Molecular Formula | C12H33N3P6Si2 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | N,N-bis[3-bis(phosphanyl)phosphanylsilylpropyl]-3-imidazol-1-ylpropan-1-amine |
| SMILES | PP(P)[SiH2]CCCN(CCC[SiH2]P(P)P)CCCn1ccnc1 |
| InChI | InChI=1S/C12H33N3P6Si2/c16-20(17)22-10-2-7-14(8-3-11-23-21(18)19)5-1-6-15-9-4-13-12-15/h4,9,12H,1-3,5-8,10-11,16-19,22-23H2 |
| InChIKey | WJRUOKBEUBVBGC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|