C24H51N3O4Si2 — CID 157021381
N,N-bis[3-[diethoxy(ethyl)silyl]propyl]-3-imidazol-1-ylpropan-1-amine (PubChem CID 157021381) has the molecular formula C24H51N3O4Si2 and a molecular weight of 501.86 g/mol. Its IUPAC name is N,N-bis[3-[diethoxy(ethyl)silyl]propyl]-3-imidazol-1-ylpropan-1-amine.
| Compound Name | N,N-bis[3-[diethoxy(ethyl)silyl]propyl]-3-imidazol-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 157021381 |
| Molecular Formula | C24H51N3O4Si2 |
| Molecular Weight | 501.86 g/mol |
| Exact Mass | 501.34 |
| IUPAC Name | N,N-bis[3-[diethoxy(ethyl)silyl]propyl]-3-imidazol-1-ylpropan-1-amine |
| SMILES | CCO[Si](CC)(CCCN(CCCn1ccnc1)CCC[Si](CC)(OCC)OCC)OCC |
| InChI | InChI=1S/C24H51N3O4Si2/c1-7-28-32(11-5,29-8-2)22-14-19-26(17-13-18-27-21-16-25-24-27)20-15-23-33(12-6,30-9-3)31-10-4/h16,21,24H,7-15,17-20,22-23H2,1-6H3 |
| InChIKey | WBGVLVHFZKEKFS-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 57.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.86 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|