C16H28O3 — CID 118605267
3-(3-oxocyclopentyl)pentan-3-yl 2,2-dimethylbutanoate (PubChem CID 118605267) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is 3-(3-oxocyclopentyl)pentan-3-yl 2,2-dimethylbutanoate.
| Compound Name | 3-(3-oxocyclopentyl)pentan-3-yl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 118605267 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 3-(3-oxocyclopentyl)pentan-3-yl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC(CC)(CC)C1CCC(=O)C1 |
| InChI | InChI=1S/C16H28O3/c1-6-15(4,5)14(18)19-16(7-2,8-3)12-9-10-13(17)11-12/h12H,6-11H2,1-5H3 |
| InChIKey | ZLRRPNNWUIWPRZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |