About 8-oxa-1λ6-thiaspiro[5.5]undecane 1,1-dioxide
8-oxa-1λ6-thiaspiro[5.5]undecane 1,1-dioxide (PubChem CID 118609043) has the molecular formula C9H16O3S
and a molecular weight of 204.29 g/mol. Its IUPAC name is 8-oxa-1λ6-thiaspiro[5.5]undecane 1,1-dioxide.
Molecular Properties
| Compound Name | 8-oxa-1λ6-thiaspiro[5.5]undecane 1,1-dioxide |
| PubChem CID | 118609043 |
| Molecular Formula | C9H16O3S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 8-oxa-1λ6-thiaspiro[5.5]undecane 1,1-dioxide |
| SMILES | O=S1(=O)CCCCC12CCCOC2 |
| InChI | InChI=1S/C9H16O3S/c10-13(11)7-2-1-4-9(13)5-3-6-12-8-9/h1-8H2 |
| InChIKey | HDMJYHXBLUOEIS-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-oxa-1λ6-thiaspiro[5.5]undecane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-oxa-1λ6-thiaspiro[5.5]undecane 1,1-dioxide?
The IUPAC name of 8-oxa-1λ6-thiaspiro[5.5]undecane 1,1-dioxide (CID 118609043) is 8-oxa-1λ6-thiaspiro[5.5]undecane 1,1-dioxide.
What is the SMILES notation for 8-oxa-1λ6-thiaspiro[5.5]undecane 1,1-dioxide?
The canonical SMILES for 8-oxa-1λ6-thiaspiro[5.5]undecane 1,1-dioxide is O=S1(=O)CCCCC12CCCOC2.
What is the InChIKey of 8-oxa-1λ6-thiaspiro[5.5]undecane 1,1-dioxide?
The InChIKey is HDMJYHXBLUOEIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3S/c10-13(11)7-2-1-4-9(13)5-3-6-12-8-9/h1-8H2.
What are the key properties of 8-oxa-1λ6-thiaspiro[5.5]undecane 1,1-dioxide?
8-oxa-1λ6-thiaspiro[5.5]undecane 1,1-dioxide has a molecular weight of 204.29 g/mol, XLogP of 1.13, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-oxa-1λ6-thiaspiro[5.5]undecane 1,1-dioxide is sourced from PubChem (CID 118609043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).